C18H20BrClF2N4O3 — CID 155055225
(3S,4R)-4-[(E)-1-bromo-2-chloro-2-[methyl-(methylideneamino)amino]ethenyl]-N-[3-fluoro-2-(1-fluoroethoxy)phenyl]-1-methyl-2-oxopyrrolidine-3-carboxamide (PubChem CID 155055225) has the molecular formula C18H20BrClF2N4O3 and a molecular weight of 493.74 g/mol. Its IUPAC name is (3S,4R)-4-[(E)-1-bromo-2-chloro-2-[methyl-(methylideneamino)amino]ethenyl]-N-[3-fluoro-2-(1-fluoroethoxy)phenyl]-1-methyl-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S,4R)-4-[(E)-1-bromo-2-chloro-2-[methyl-(methylideneamino)amino]ethenyl]-N-[3-fluoro-2-(1-fluoroethoxy)phenyl]-1-methyl-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 155055225 |
| Molecular Formula | C18H20BrClF2N4O3 |
| Molecular Weight | 493.74 g/mol |
| Exact Mass | 492.04 |
| IUPAC Name | (3S,4R)-4-[(E)-1-bromo-2-chloro-2-[methyl-(methylideneamino)amino]ethenyl]-N-[3-fluoro-2-(1-fluoroethoxy)phenyl]-1-methyl-2-oxopyrrolidine-3-carboxamide |
| SMILES | C=NN(C)/C(Cl)=C(\Br)[C@H]1CN(C)C(=O)[C@@H]1C(=O)Nc1cccc(F)c1OC(C)F |
| InChI | InChI=1S/C18H20BrClF2N4O3/c1-9(21)29-15-11(22)6-5-7-12(15)24-17(27)13-10(8-25(3)18(13)28)14(19)16(20)26(4)23-2/h5-7,9-10,13H,2,8H2,1,3-4H3,(H,24,27)/b16-14-/t9?,10-,13-/m0/s1 |
| InChIKey | BTYPXCHTOWTADQ-HIALYVCUSA-N |
| XLogP | 3.51 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.74 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|