C14H14BrF3N3O4S+ — CID 154673752
3-[3-bromo-4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyridin-1-ium-1-yl]propanoic acid;methyl acetate (PubChem CID 154673752) has the molecular formula C14H14BrF3N3O4S+ and a molecular weight of 457.25 g/mol. Its IUPAC name is 3-[3-bromo-4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyridin-1-ium-1-yl]propanoic acid;methyl acetate.
| Compound Name | 3-[3-bromo-4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyridin-1-ium-1-yl]propanoic acid;methyl acetate |
|---|---|
| PubChem CID | 154673752 |
| Molecular Formula | C14H14BrF3N3O4S+ |
| Molecular Weight | 457.25 g/mol |
| Exact Mass | 455.98 |
| IUPAC Name | 3-[3-bromo-4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyridin-1-ium-1-yl]propanoic acid;methyl acetate |
| SMILES | COC(C)=O.O=C(O)CC[n+]1ccc(-c2nc(C(F)(F)F)ns2)c(Br)c1 |
| InChI | InChI=1S/C11H7BrF3N3O2S.C3H6O2/c12-7-5-18(4-2-8(19)20)3-1-6(7)9-16-10(17-21-9)11(13,14)15;1-3(4)5-2/h1,3,5H,2,4H2;1-2H3/p+1 |
| InChIKey | KDTWXVXSUJQOLA-UHFFFAOYSA-O |
| XLogP | 2.93 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|