C10H9FN3O2S+ — CID 154673798
3-[3-fluoro-4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]propanoic acid (PubChem CID 154673798) has the molecular formula C10H9FN3O2S+ and a molecular weight of 254.27 g/mol. Its IUPAC name is 3-[3-fluoro-4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]propanoic acid.
| Compound Name | 3-[3-fluoro-4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]propanoic acid |
|---|---|
| PubChem CID | 154673798 |
| Molecular Formula | C10H9FN3O2S+ |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 3-[3-fluoro-4-(1,2,4-thiadiazol-5-yl)pyridin-1-ium-1-yl]propanoic acid |
| SMILES | O=C(O)CC[n+]1ccc(-c2ncns2)c(F)c1 |
| InChI | InChI=1S/C10H8FN3O2S/c11-8-5-14(4-2-9(15)16)3-1-7(8)10-12-6-13-17-10/h1,3,5-6H,2,4H2/p+1 |
| InChIKey | SVYFHHROIVLTLT-UHFFFAOYSA-O |
| XLogP | 1.11 |
| TPSA | 66.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|