C11H9F3N2O4S — CID 154673830
2-[4-[4-(trifluoromethyl)-1,3-oxazol-2-yl]pyridin-1-ium-1-yl]ethanesulfonate (PubChem CID 154673830) has the molecular formula C11H9F3N2O4S and a molecular weight of 322.26 g/mol. Its IUPAC name is 2-[4-[4-(trifluoromethyl)-1,3-oxazol-2-yl]pyridin-1-ium-1-yl]ethanesulfonate.
| Compound Name | 2-[4-[4-(trifluoromethyl)-1,3-oxazol-2-yl]pyridin-1-ium-1-yl]ethanesulfonate |
|---|---|
| PubChem CID | 154673830 |
| Molecular Formula | C11H9F3N2O4S |
| Molecular Weight | 322.26 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 2-[4-[4-(trifluoromethyl)-1,3-oxazol-2-yl]pyridin-1-ium-1-yl]ethanesulfonate |
| SMILES | O=S(=O)([O-])CC[n+]1ccc(-c2nc(C(F)(F)F)co2)cc1 |
| InChI | InChI=1S/C11H9F3N2O4S/c12-11(13,14)9-7-20-10(15-9)8-1-3-16(4-2-8)5-6-21(17,18)19/h1-4,7H,5-6H2 |
| InChIKey | BLUVWGOGABAHNV-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 87.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.26 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|