C20H24BrN3O3 — CID 154675040
tert-butyl 3-(2-amino-4-bromo-3-phenoxyanilino)azetidine-1-carboxylate (PubChem CID 154675040) has the molecular formula C20H24BrN3O3 and a molecular weight of 434.33 g/mol. Its IUPAC name is tert-butyl 3-(2-amino-4-bromo-3-phenoxyanilino)azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-(2-amino-4-bromo-3-phenoxyanilino)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 154675040 |
| Molecular Formula | C20H24BrN3O3 |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | tert-butyl 3-(2-amino-4-bromo-3-phenoxyanilino)azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(Nc2ccc(Br)c(Oc3ccccc3)c2N)C1 |
| InChI | InChI=1S/C20H24BrN3O3/c1-20(2,3)27-19(25)24-11-13(12-24)23-16-10-9-15(21)18(17(16)22)26-14-7-5-4-6-8-14/h4-10,13,23H,11-12,22H2,1-3H3 |
| InChIKey | VMUOLHKFIPISNZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|