C24H24F3N3O5S — CID 154675720
tert-butyl 4-[[(Z)-[3-[5-methyl-2-(2,2,2-trifluoroethoxy)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]carbamoyl]amino]benzoate (PubChem CID 154675720) has the molecular formula C24H24F3N3O5S and a molecular weight of 523.53 g/mol. Its IUPAC name is tert-butyl 4-[[(Z)-[3-[5-methyl-2-(2,2,2-trifluoroethoxy)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]carbamoyl]amino]benzoate.
| Compound Name | tert-butyl 4-[[(Z)-[3-[5-methyl-2-(2,2,2-trifluoroethoxy)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]carbamoyl]amino]benzoate |
|---|---|
| PubChem CID | 154675720 |
| Molecular Formula | C24H24F3N3O5S |
| Molecular Weight | 523.53 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | tert-butyl 4-[[(Z)-[3-[5-methyl-2-(2,2,2-trifluoroethoxy)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]carbamoyl]amino]benzoate |
| SMILES | Cc1ccc(OCC(F)(F)F)c(N2C(=O)CS/C2=N\C(=O)Nc2ccc(C(=O)OC(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C24H24F3N3O5S/c1-14-5-10-18(34-13-24(25,26)27)17(11-14)30-19(31)12-36-22(30)29-21(33)28-16-8-6-15(7-9-16)20(32)35-23(2,3)4/h5-11H,12-13H2,1-4H3,(H,28,33)/b29-22- |
| InChIKey | FWFIKBZXOFYUDL-IADYIPOJSA-N |
| XLogP | 5.56 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.53 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|