C24H24F3N7O2S2 — CID 138722036
(3Z)-1-[1-[4-(1-methyl-1,2,4-triazol-3-yl)phenyl]ethylamino]-3-[3-[5-methyl-2-(2,2,2-trifluoroethoxy)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]thiourea (PubChem CID 138722036) has the molecular formula C24H24F3N7O2S2 and a molecular weight of 563.63 g/mol. Its IUPAC name is (3Z)-1-[1-[4-(1-methyl-1,2,4-triazol-3-yl)phenyl]ethylamino]-3-[3-[5-methyl-2-(2,2,2-trifluoroethoxy)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]thiourea.
| Compound Name | (3Z)-1-[1-[4-(1-methyl-1,2,4-triazol-3-yl)phenyl]ethylamino]-3-[3-[5-methyl-2-(2,2,2-trifluoroethoxy)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]thiourea |
|---|---|
| PubChem CID | 138722036 |
| Molecular Formula | C24H24F3N7O2S2 |
| Molecular Weight | 563.63 g/mol |
| Exact Mass | 563.14 |
| IUPAC Name | (3Z)-1-[1-[4-(1-methyl-1,2,4-triazol-3-yl)phenyl]ethylamino]-3-[3-[5-methyl-2-(2,2,2-trifluoroethoxy)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]thiourea |
| SMILES | Cc1ccc(OCC(F)(F)F)c(N2C(=O)CS/C2=N\C(=S)NNC(C)c2ccc(-c3ncn(C)n3)cc2)c1 |
| InChI | InChI=1S/C24H24F3N7O2S2/c1-14-4-9-19(36-12-24(25,26)27)18(10-14)34-20(35)11-38-23(34)29-22(37)31-30-15(2)16-5-7-17(8-6-16)21-28-13-33(3)32-21/h4-10,13,15,30H,11-12H2,1-3H3,(H,31,37)/b29-23- |
| InChIKey | MUDCVDWJFPDFID-FAJYDZGRSA-N |
| XLogP | 4.31 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.63 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|