C22H19ClF3N7O2S2 — CID 138722038
(1Z)-1-[3-[5-chloro-2-(trifluoromethoxy)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]-3-[1-[4-(1-methyl-1,2,4-triazol-3-yl)phenyl]ethylamino]thiourea (PubChem CID 138722038) has the molecular formula C22H19ClF3N7O2S2 and a molecular weight of 570.02 g/mol. Its IUPAC name is (1Z)-1-[3-[5-chloro-2-(trifluoromethoxy)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]-3-[1-[4-(1-methyl-1,2,4-triazol-3-yl)phenyl]ethylamino]thiourea.
| Compound Name | (1Z)-1-[3-[5-chloro-2-(trifluoromethoxy)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]-3-[1-[4-(1-methyl-1,2,4-triazol-3-yl)phenyl]ethylamino]thiourea |
|---|---|
| PubChem CID | 138722038 |
| Molecular Formula | C22H19ClF3N7O2S2 |
| Molecular Weight | 570.02 g/mol |
| Exact Mass | 569.07 |
| IUPAC Name | (1Z)-1-[3-[5-chloro-2-(trifluoromethoxy)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]-3-[1-[4-(1-methyl-1,2,4-triazol-3-yl)phenyl]ethylamino]thiourea |
| SMILES | CC(NNC(=S)/N=C1\SCC(=O)N1c1cc(Cl)ccc1OC(F)(F)F)c1ccc(-c2ncn(C)n2)cc1 |
| InChI | InChI=1S/C22H19ClF3N7O2S2/c1-12(13-3-5-14(6-4-13)19-27-11-32(2)31-19)29-30-20(36)28-21-33(18(34)10-37-21)16-9-15(23)7-8-17(16)35-22(24,25)26/h3-9,11-12,29H,10H2,1-2H3,(H,30,36)/b28-21- |
| InChIKey | SUSXITSPVVHIFD-HFTWOUSFSA-N |
| XLogP | 4.61 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.02 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|