C40H47N5 — CID 154679125
4-[8,13-bis(ethenyl)-3,7,12,17-tetramethyl-18-(3-methylbut-3-enyl)-22,23-dihydroporphyrin-2-yl]-N-propylbut-1-en-2-amine (PubChem CID 154679125) has the molecular formula C40H47N5 and a molecular weight of 597.85 g/mol. Its IUPAC name is 4-[8,13-bis(ethenyl)-3,7,12,17-tetramethyl-18-(3-methylbut-3-enyl)-22,23-dihydroporphyrin-2-yl]-N-propylbut-1-en-2-amine.
| Compound Name | 4-[8,13-bis(ethenyl)-3,7,12,17-tetramethyl-18-(3-methylbut-3-enyl)-22,23-dihydroporphyrin-2-yl]-N-propylbut-1-en-2-amine |
|---|---|
| PubChem CID | 154679125 |
| Molecular Formula | C40H47N5 |
| Molecular Weight | 597.85 g/mol |
| Exact Mass | 597.38 |
| IUPAC Name | 4-[8,13-bis(ethenyl)-3,7,12,17-tetramethyl-18-(3-methylbut-3-enyl)-22,23-dihydroporphyrin-2-yl]-N-propylbut-1-en-2-amine |
| SMILES | C=Cc1c(C)c2cc3[nH]c(cc4nc(cc5nc(cc1[nH]2)C(C)=C5CCC(=C)C)C(CCC(=C)NCCC)=C4C)c(C)c3C=C |
| InChI | InChI=1S/C40H47N5/c1-11-18-41-24(6)15-17-32-28(10)34-19-33-25(7)29(12-2)37(42-33)20-35-26(8)30(13-3)38(43-35)21-36-27(9)31(16-14-23(4)5)39(45-36)22-40(32)44-34/h12-13,19-22,41-43H,2-4,6,11,14-18H2,1,5,7-10H3/b33-19-,34-19-,35-20-,36-21-,37-20-,38-21-,39-22-,40-22- |
| InChIKey | MXXUNVQPYAMEDN-DLSLMHDPSA-N |
| XLogP | 10.73 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.85 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|