C21H17ClN6O3 — CID 154679859
5-[5-chloro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-3-[4-(1,2,4-triazol-1-yl)phenyl]-1,2-oxazole (PubChem CID 154679859) has the molecular formula C21H17ClN6O3 and a molecular weight of 436.86 g/mol. Its IUPAC name is 5-[5-chloro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-3-[4-(1,2,4-triazol-1-yl)phenyl]-1,2-oxazole.
| Compound Name | 5-[5-chloro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-3-[4-(1,2,4-triazol-1-yl)phenyl]-1,2-oxazole |
|---|---|
| PubChem CID | 154679859 |
| Molecular Formula | C21H17ClN6O3 |
| Molecular Weight | 436.86 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 5-[5-chloro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-3-[4-(1,2,4-triazol-1-yl)phenyl]-1,2-oxazole |
| SMILES | COCCOc1cc2[nH]nc(-c3cc(-c4ccc(-n5cncn5)cc4)no3)c2cc1Cl |
| InChI | InChI=1S/C21H17ClN6O3/c1-29-6-7-30-19-10-18-15(8-16(19)22)21(26-25-18)20-9-17(27-31-20)13-2-4-14(5-3-13)28-12-23-11-24-28/h2-5,8-12H,6-7H2,1H3,(H,25,26) |
| InChIKey | LOKPCDVCQXPQNB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 103.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.86 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|