C27H28N6O4 — CID 164745507
[(2S)-2,4-dimethylpiperazin-1-yl]-[4-[3-[5-isocyano-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-5-yl]phenyl]methanone (PubChem CID 164745507) has the molecular formula C27H28N6O4 and a molecular weight of 500.56 g/mol. Its IUPAC name is [(2S)-2,4-dimethylpiperazin-1-yl]-[4-[3-[5-isocyano-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-5-yl]phenyl]methanone.
| Compound Name | [(2S)-2,4-dimethylpiperazin-1-yl]-[4-[3-[5-isocyano-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-5-yl]phenyl]methanone |
|---|---|
| PubChem CID | 164745507 |
| Molecular Formula | C27H28N6O4 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | [(2S)-2,4-dimethylpiperazin-1-yl]-[4-[3-[5-isocyano-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-5-yl]phenyl]methanone |
| SMILES | [C-]#[N+]c1cc2c(-c3cc(-c4ccc(C(=O)N5CCN(C)C[C@@H]5C)cc4)on3)n[nH]c2cc1OCCOC |
| InChI | InChI=1S/C27H28N6O4/c1-17-16-32(3)9-10-33(17)27(34)19-7-5-18(6-8-19)24-15-23(31-37-24)26-20-13-22(28-2)25(36-12-11-35-4)14-21(20)29-30-26/h5-8,13-15,17H,9-12,16H2,1,3-4H3,(H,29,30)/t17-/m0/s1 |
| InChIKey | SFBPLOOIZAAHMV-KRWDZBQOSA-N |
| XLogP | 4.24 |
| TPSA | 101.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|