C24H23FN4O5 — CID 154679620
[4-[3-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-5-yl]phenyl]-morpholin-4-ylmethanone (PubChem CID 154679620) has the molecular formula C24H23FN4O5 and a molecular weight of 466.47 g/mol. Its IUPAC name is [4-[3-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-5-yl]phenyl]-morpholin-4-ylmethanone.
| Compound Name | [4-[3-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-5-yl]phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 154679620 |
| Molecular Formula | C24H23FN4O5 |
| Molecular Weight | 466.47 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | [4-[3-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-5-yl]phenyl]-morpholin-4-ylmethanone |
| SMILES | COCCOc1cc2[nH]nc(-c3cc(-c4ccc(C(=O)N5CCOCC5)cc4)on3)c2cc1F |
| InChI | InChI=1S/C24H23FN4O5/c1-31-10-11-33-22-13-19-17(12-18(22)25)23(27-26-19)20-14-21(34-28-20)15-2-4-16(5-3-15)24(30)29-6-8-32-9-7-29/h2-5,12-14H,6-11H2,1H3,(H,26,27) |
| InChIKey | LSYFKJVLVMOGCM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 102.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|