C25H25FN4O5 — CID 154679631
[4-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]phenyl]-[(2S)-2-methylmorpholin-4-yl]methanone (PubChem CID 154679631) has the molecular formula C25H25FN4O5 and a molecular weight of 480.50 g/mol. Its IUPAC name is [4-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]phenyl]-[(2S)-2-methylmorpholin-4-yl]methanone.
| Compound Name | [4-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]phenyl]-[(2S)-2-methylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 154679631 |
| Molecular Formula | C25H25FN4O5 |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | [4-[5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-1,2-oxazol-3-yl]phenyl]-[(2S)-2-methylmorpholin-4-yl]methanone |
| SMILES | COCCOc1cc2[nH]nc(-c3cc(-c4ccc(C(=O)N5CCO[C@@H](C)C5)cc4)no3)c2cc1F |
| InChI | InChI=1S/C25H25FN4O5/c1-15-14-30(7-8-33-15)25(31)17-5-3-16(4-6-17)20-12-23(35-29-20)24-18-11-19(26)22(34-10-9-32-2)13-21(18)27-28-24/h3-6,11-13,15H,7-10,14H2,1-2H3,(H,27,28)/t15-/m0/s1 |
| InChIKey | ACBKMNLKGRZESF-HNNXBMFYSA-N |
| XLogP | 3.91 |
| TPSA | 102.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|