C24H25FN6O4 — CID 155067285
[4-[4-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]triazol-1-yl]phenyl]-[(3R)-3-methylmorpholin-4-yl]methanone (PubChem CID 155067285) has the molecular formula C24H25FN6O4 and a molecular weight of 480.50 g/mol. Its IUPAC name is [4-[4-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]triazol-1-yl]phenyl]-[(3R)-3-methylmorpholin-4-yl]methanone.
| Compound Name | [4-[4-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]triazol-1-yl]phenyl]-[(3R)-3-methylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 155067285 |
| Molecular Formula | C24H25FN6O4 |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | [4-[4-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]triazol-1-yl]phenyl]-[(3R)-3-methylmorpholin-4-yl]methanone |
| SMILES | COCCOc1cc2[nH]nc(-c3cn(-c4ccc(C(=O)N5CCOC[C@H]5C)cc4)nn3)c2cc1F |
| InChI | InChI=1S/C24H25FN6O4/c1-15-14-34-8-7-30(15)24(32)16-3-5-17(6-4-16)31-13-21(27-29-31)23-18-11-19(25)22(35-10-9-33-2)12-20(18)26-28-23/h3-6,11-13,15H,7-10,14H2,1-2H3,(H,26,28)/t15-/m1/s1 |
| InChIKey | XDSPZDLTLZFXTC-OAHLLOKOSA-N |
| XLogP | 2.84 |
| TPSA | 107.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|