C27H30FN5O4 — CID 155067519
5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-3-[4-[4-(oxetan-3-yl)-1,4-diazepan-1-yl]phenyl]-1,2-oxazole (PubChem CID 155067519) has the molecular formula C27H30FN5O4 and a molecular weight of 507.57 g/mol. Its IUPAC name is 5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-3-[4-[4-(oxetan-3-yl)-1,4-diazepan-1-yl]phenyl]-1,2-oxazole.
| Compound Name | 5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-3-[4-[4-(oxetan-3-yl)-1,4-diazepan-1-yl]phenyl]-1,2-oxazole |
|---|---|
| PubChem CID | 155067519 |
| Molecular Formula | C27H30FN5O4 |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | 5-[5-fluoro-6-(2-methoxyethoxy)-1H-indazol-3-yl]-3-[4-[4-(oxetan-3-yl)-1,4-diazepan-1-yl]phenyl]-1,2-oxazole |
| SMILES | COCCOc1cc2[nH]nc(-c3cc(-c4ccc(N5CCCN(C6COC6)CC5)cc4)no3)c2cc1F |
| InChI | InChI=1S/C27H30FN5O4/c1-34-11-12-36-25-15-24-21(13-22(25)28)27(30-29-24)26-14-23(31-37-26)18-3-5-19(6-4-18)32-7-2-8-33(10-9-32)20-16-35-17-20/h3-6,13-15,20H,2,7-12,16-17H2,1H3,(H,29,30) |
| InChIKey | BXQPOERDPFTUDP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 88.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|