C16H18BrCl2N3O2S — CID 154681263
(2R,3R)-3-amino-4-[3-bromo-5-chloro-7-(furan-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]butan-2-ol;hydrochloride (PubChem CID 154681263) has the molecular formula C16H18BrCl2N3O2S and a molecular weight of 467.22 g/mol. Its IUPAC name is (2R,3R)-3-amino-4-[3-bromo-5-chloro-7-(furan-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]butan-2-ol;hydrochloride.
| Compound Name | (2R,3R)-3-amino-4-[3-bromo-5-chloro-7-(furan-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]butan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 154681263 |
| Molecular Formula | C16H18BrCl2N3O2S |
| Molecular Weight | 467.22 g/mol |
| Exact Mass | 464.97 |
| IUPAC Name | (2R,3R)-3-amino-4-[3-bromo-5-chloro-7-(furan-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]butan-2-ol;hydrochloride |
| SMILES | C[C@@H](O)[C@H](N)Cc1sc2c(NCc3ccco3)cc(Cl)nc2c1Br.Cl |
| InChI | InChI=1S/C16H17BrClN3O2S.ClH/c1-8(22)10(19)5-12-14(17)15-16(24-12)11(6-13(18)21-15)20-7-9-3-2-4-23-9;/h2-4,6,8,10,22H,5,7,19H2,1H3,(H,20,21);1H/t8-,10-;/m1./s1 |
| InChIKey | OCBDGUVGXBWNLR-GHXDPTCOSA-N |
| XLogP | 4.59 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.22 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|