C18H34O4 — CID 154684442
ethane;4-hydroxybutyl (3R)-2,2,3-trimethyl-3-propanoylcyclopentane-1-carboxylate (PubChem CID 154684442) has the molecular formula C18H34O4 and a molecular weight of 314.47 g/mol. Its IUPAC name is ethane;4-hydroxybutyl (3R)-2,2,3-trimethyl-3-propanoylcyclopentane-1-carboxylate.
| Compound Name | ethane;4-hydroxybutyl (3R)-2,2,3-trimethyl-3-propanoylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 154684442 |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | ethane;4-hydroxybutyl (3R)-2,2,3-trimethyl-3-propanoylcyclopentane-1-carboxylate |
| SMILES | CC.CCC(=O)[C@]1(C)CCC(C(=O)OCCCCO)C1(C)C |
| InChI | InChI=1S/C16H28O4.C2H6/c1-5-13(18)16(4)9-8-12(15(16,2)3)14(19)20-11-7-6-10-17;1-2/h12,17H,5-11H2,1-4H3;1-2H3/t12?,16-;/m0./s1 |
| InChIKey | LINLGQAXSWIASA-LDYGMWQQSA-N |
| XLogP | 3.75 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|