C16H20 — CID 154688085
4-prop-1-en-2-yl-2,3,4,6,7,9-hexahydro-1H-fluorene (PubChem CID 154688085) has the molecular formula C16H20 and a molecular weight of 212.34 g/mol. Its IUPAC name is 4-prop-1-en-2-yl-2,3,4,6,7,9-hexahydro-1H-fluorene.
| Compound Name | 4-prop-1-en-2-yl-2,3,4,6,7,9-hexahydro-1H-fluorene |
|---|---|
| PubChem CID | 154688085 |
| Molecular Formula | C16H20 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 4-prop-1-en-2-yl-2,3,4,6,7,9-hexahydro-1H-fluorene |
| SMILES | C=C(C)C1CCCC2=C1C1=CCCC=C1C2 |
| InChI | InChI=1S/C16H20/c1-11(2)14-9-5-7-13-10-12-6-3-4-8-15(12)16(13)14/h6,8,14H,1,3-5,7,9-10H2,2H3 |
| InChIKey | WNEOMAULEWRUGQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|