C11H14O — CID 163706479
tricyclo[5.3.1.03,11]undeca-1(10),7(11)-dien-2-ol (PubChem CID 163706479) has the molecular formula C11H14O and a molecular weight of 162.23 g/mol. Its IUPAC name is tricyclo[5.3.1.03,11]undeca-1(10),7(11)-dien-2-ol.
| Compound Name | tricyclo[5.3.1.03,11]undeca-1(10),7(11)-dien-2-ol |
|---|---|
| PubChem CID | 163706479 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | tricyclo[5.3.1.03,11]undeca-1(10),7(11)-dien-2-ol |
| SMILES | OC1C2=CCCC3=C2C1CCC3 |
| InChI | InChI=1S/C11H14O/c12-11-8-5-1-3-7-4-2-6-9(11)10(7)8/h5,9,11-12H,1-4,6H2 |
| InChIKey | KFMOEDHYXMFFPG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |