C24H40O9 — CID 154699867
(2S,3S,4S,5R)-6-[(6S,7E,9Z)-17-carboxyheptadeca-7,9-dien-6-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 154699867) has the molecular formula C24H40O9 and a molecular weight of 472.58 g/mol. Its IUPAC name is (2S,3S,4S,5R)-6-[(6S,7E,9Z)-17-carboxyheptadeca-7,9-dien-6-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R)-6-[(6S,7E,9Z)-17-carboxyheptadeca-7,9-dien-6-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 154699867 |
| Molecular Formula | C24H40O9 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | (2S,3S,4S,5R)-6-[(6S,7E,9Z)-17-carboxyheptadeca-7,9-dien-6-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | CCCCC[C@@H](/C=C/C=C\CCCCCCCC(=O)O)OC1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C24H40O9/c1-2-3-11-14-17(15-12-9-7-5-4-6-8-10-13-16-18(25)26)32-24-21(29)19(27)20(28)22(33-24)23(30)31/h7,9,12,15,17,19-22,24,27-29H,2-6,8,10-11,13-14,16H2,1H3,(H,25,26)(H,30,31)/b9-7-,15-12+/t17-,19-,20-,21+,22-,24?/m0/s1 |
| InChIKey | PARPHFPLQDJYGI-SGLWAERKSA-N |
| XLogP | 2.77 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|