C20H20N2O4 — CID 154700821
(E)-4-[5,8-dimethoxy-6-methyl-4-(5-methylfuran-2-yl)cinnolin-3-yl]but-3-en-2-one (PubChem CID 154700821) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is (E)-4-[5,8-dimethoxy-6-methyl-4-(5-methylfuran-2-yl)cinnolin-3-yl]but-3-en-2-one.
| Compound Name | (E)-4-[5,8-dimethoxy-6-methyl-4-(5-methylfuran-2-yl)cinnolin-3-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 154700821 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | (E)-4-[5,8-dimethoxy-6-methyl-4-(5-methylfuran-2-yl)cinnolin-3-yl]but-3-en-2-one |
| SMILES | COc1cc(C)c(OC)c2c(-c3ccc(C)o3)c(/C=C/C(C)=O)nnc12 |
| InChI | InChI=1S/C20H20N2O4/c1-11-10-16(24-4)19-18(20(11)25-5)17(15-9-7-13(3)26-15)14(21-22-19)8-6-12(2)23/h6-10H,1-5H3/b8-6+ |
| InChIKey | BKFHSPZMUQTONJ-SOFGYWHQSA-N |
| XLogP | 4.13 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|