C25H32N8O4S — CID 154702440
6-amino-2-butoxy-9-[[6-[4-[(2-methylsulfonylethylamino)methyl]anilino]-3-pyridinyl]methyl]-7H-purin-8-one (PubChem CID 154702440) has the molecular formula C25H32N8O4S and a molecular weight of 540.65 g/mol. Its IUPAC name is 6-amino-2-butoxy-9-[[6-[4-[(2-methylsulfonylethylamino)methyl]anilino]-3-pyridinyl]methyl]-7H-purin-8-one.
| Compound Name | 6-amino-2-butoxy-9-[[6-[4-[(2-methylsulfonylethylamino)methyl]anilino]-3-pyridinyl]methyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 154702440 |
| Molecular Formula | C25H32N8O4S |
| Molecular Weight | 540.65 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | 6-amino-2-butoxy-9-[[6-[4-[(2-methylsulfonylethylamino)methyl]anilino]-3-pyridinyl]methyl]-7H-purin-8-one |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(Nc4ccc(CNCCS(C)(=O)=O)cc4)nc3)c2n1 |
| InChI | InChI=1S/C25H32N8O4S/c1-3-4-12-37-24-31-22(26)21-23(32-24)33(25(34)30-21)16-18-7-10-20(28-15-18)29-19-8-5-17(6-9-19)14-27-11-13-38(2,35)36/h5-10,15,27H,3-4,11-14,16H2,1-2H3,(H,28,29)(H,30,34)(H2,26,31,32) |
| InChIKey | AXSXBHMCCXIUDY-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 169.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.65 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|