C23H25BN2O3 — CID 154703053
1-naphthalen-1-yl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea (PubChem CID 154703053) has the molecular formula C23H25BN2O3 and a molecular weight of 388.28 g/mol. Its IUPAC name is 1-naphthalen-1-yl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea.
| Compound Name | 1-naphthalen-1-yl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 154703053 |
| Molecular Formula | C23H25BN2O3 |
| Molecular Weight | 388.28 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 1-naphthalen-1-yl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea |
| SMILES | CC1(C)OB(c2ccc(N(C(N)=O)c3cccc4ccccc34)cc2)OC1(C)C |
| InChI | InChI=1S/C23H25BN2O3/c1-22(2)23(3,4)29-24(28-22)17-12-14-18(15-13-17)26(21(25)27)20-11-7-9-16-8-5-6-10-19(16)20/h5-15H,1-4H3,(H2,25,27) |
| InChIKey | XZLPMIRISQQBDN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.28 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|