C21H31NO — CID 154706947
2-[(E)-2-cyclohexylethenyl]-N,N-di(propan-2-yl)benzamide (PubChem CID 154706947) has the molecular formula C21H31NO and a molecular weight of 313.49 g/mol. Its IUPAC name is 2-[(E)-2-cyclohexylethenyl]-N,N-di(propan-2-yl)benzamide.
| Compound Name | 2-[(E)-2-cyclohexylethenyl]-N,N-di(propan-2-yl)benzamide |
|---|---|
| PubChem CID | 154706947 |
| Molecular Formula | C21H31NO |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | 2-[(E)-2-cyclohexylethenyl]-N,N-di(propan-2-yl)benzamide |
| SMILES | CC(C)N(C(=O)c1ccccc1/C=C/C1CCCCC1)C(C)C |
| InChI | InChI=1S/C21H31NO/c1-16(2)22(17(3)4)21(23)20-13-9-8-12-19(20)15-14-18-10-6-5-7-11-18/h8-9,12-18H,5-7,10-11H2,1-4H3/b15-14+ |
| InChIKey | OAROMSAMTYDQOG-CCEZHUSRSA-N |
| XLogP | 5.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |