C25H53BO4Si2 — CID 154712424
tert-butyl-[(2S,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-6-enoxy]-dimethylsilane (PubChem CID 154712424) has the molecular formula C25H53BO4Si2 and a molecular weight of 484.68 g/mol. Its IUPAC name is tert-butyl-[(2S,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-6-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2S,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-6-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 154712424 |
| Molecular Formula | C25H53BO4Si2 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.36 |
| IUPAC Name | tert-butyl-[(2S,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-6-enoxy]-dimethylsilane |
| SMILES | C=CC[C@H](C[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C25H53BO4Si2/c1-16-17-20(26-29-24(8,9)25(10,11)30-26)18-21(28-32(14,15)23(5,6)7)19-27-31(12,13)22(2,3)4/h16,20-21H,1,17-19H2,2-15H3/t20-,21+/m1/s1 |
| InChIKey | QPQLTKMHDOUPFH-RTWAWAEBSA-N |
| XLogP | 7.83 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|