C30H42FNO6 — CID 154714051
benzyl 3-(1-adamantyl)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-fluoropropanoate (PubChem CID 154714051) has the molecular formula C30H42FNO6 and a molecular weight of 531.67 g/mol. Its IUPAC name is benzyl 3-(1-adamantyl)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-fluoropropanoate.
| Compound Name | benzyl 3-(1-adamantyl)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-fluoropropanoate |
|---|---|
| PubChem CID | 154714051 |
| Molecular Formula | C30H42FNO6 |
| Molecular Weight | 531.67 g/mol |
| Exact Mass | 531.30 |
| IUPAC Name | benzyl 3-(1-adamantyl)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-fluoropropanoate |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)C(F)(CC12CC3CC(CC(C3)C1)C2)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H42FNO6/c1-27(2,3)37-25(34)32(26(35)38-28(4,5)6)30(31,24(33)36-18-20-10-8-7-9-11-20)19-29-15-21-12-22(16-29)14-23(13-21)17-29/h7-11,21-23H,12-19H2,1-6H3 |
| InChIKey | OUAMACDJKCBAAV-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.67 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|