C24H34FNO6 — CID 154714090
benzyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-cyclobutyl-2-fluoropropanoate (PubChem CID 154714090) has the molecular formula C24H34FNO6 and a molecular weight of 451.54 g/mol. Its IUPAC name is benzyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-cyclobutyl-2-fluoropropanoate.
| Compound Name | benzyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-cyclobutyl-2-fluoropropanoate |
|---|---|
| PubChem CID | 154714090 |
| Molecular Formula | C24H34FNO6 |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | benzyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-cyclobutyl-2-fluoropropanoate |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)C(F)(CC1CCC1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H34FNO6/c1-22(2,3)31-20(28)26(21(29)32-23(4,5)6)24(25,15-17-13-10-14-17)19(27)30-16-18-11-8-7-9-12-18/h7-9,11-12,17H,10,13-16H2,1-6H3 |
| InChIKey | HHZPTZWNBFKZNC-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|