C26H32Si2 — CID 154718296
[2-[dimethyl(phenyl)silyl]-1-(4-methylphenyl)prop-2-enyl]-dimethyl-phenylsilane (PubChem CID 154718296) has the molecular formula C26H32Si2 and a molecular weight of 400.71 g/mol. Its IUPAC name is [2-[dimethyl(phenyl)silyl]-1-(4-methylphenyl)prop-2-enyl]-dimethyl-phenylsilane.
| Compound Name | [2-[dimethyl(phenyl)silyl]-1-(4-methylphenyl)prop-2-enyl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 154718296 |
| Molecular Formula | C26H32Si2 |
| Molecular Weight | 400.71 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | [2-[dimethyl(phenyl)silyl]-1-(4-methylphenyl)prop-2-enyl]-dimethyl-phenylsilane |
| SMILES | C=C(C(c1ccc(C)cc1)[Si](C)(C)c1ccccc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C26H32Si2/c1-21-17-19-23(20-18-21)26(28(5,6)25-15-11-8-12-16-25)22(2)27(3,4)24-13-9-7-10-14-24/h7-20,26H,2H2,1,3-6H3 |
| InChIKey | RKKYTGIUOUMAMR-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.71 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|