C24H27NO6S — CID 154720265
ethyl (3S,3aR,7aR)-7a-ethyl-1-(4-methylphenyl)sulfonyl-2,5-dioxospiro[3a,4-dihydroindole-3,4'-cyclopentene]-1'-carboxylate (PubChem CID 154720265) has the molecular formula C24H27NO6S and a molecular weight of 457.55 g/mol. Its IUPAC name is ethyl (3S,3aR,7aR)-7a-ethyl-1-(4-methylphenyl)sulfonyl-2,5-dioxospiro[3a,4-dihydroindole-3,4'-cyclopentene]-1'-carboxylate.
| Compound Name | ethyl (3S,3aR,7aR)-7a-ethyl-1-(4-methylphenyl)sulfonyl-2,5-dioxospiro[3a,4-dihydroindole-3,4'-cyclopentene]-1'-carboxylate |
|---|---|
| PubChem CID | 154720265 |
| Molecular Formula | C24H27NO6S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | ethyl (3S,3aR,7aR)-7a-ethyl-1-(4-methylphenyl)sulfonyl-2,5-dioxospiro[3a,4-dihydroindole-3,4'-cyclopentene]-1'-carboxylate |
| SMILES | CCOC(=O)C1=CC[C@@]2(C1)C(=O)N(S(=O)(=O)c1ccc(C)cc1)[C@]1(CC)C=CC(=O)C[C@H]21 |
| InChI | InChI=1S/C24H27NO6S/c1-4-24-13-11-18(26)14-20(24)23(12-10-17(15-23)21(27)31-5-2)22(28)25(24)32(29,30)19-8-6-16(3)7-9-19/h6-11,13,20H,4-5,12,14-15H2,1-3H3/t20-,23+,24-/m1/s1 |
| InChIKey | RIKLBUKZQVZKSS-FGCOXFRFSA-N |
| XLogP | 3.09 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |