C33H29NO6S — CID 154720272
benzyl (3S,3aR,7aR)-1-(4-methylphenyl)sulfonyl-2,5-dioxo-7a-phenylspiro[3a,4-dihydroindole-3,4'-cyclopentene]-1'-carboxylate (PubChem CID 154720272) has the molecular formula C33H29NO6S and a molecular weight of 567.66 g/mol. Its IUPAC name is benzyl (3S,3aR,7aR)-1-(4-methylphenyl)sulfonyl-2,5-dioxo-7a-phenylspiro[3a,4-dihydroindole-3,4'-cyclopentene]-1'-carboxylate.
| Compound Name | benzyl (3S,3aR,7aR)-1-(4-methylphenyl)sulfonyl-2,5-dioxo-7a-phenylspiro[3a,4-dihydroindole-3,4'-cyclopentene]-1'-carboxylate |
|---|---|
| PubChem CID | 154720272 |
| Molecular Formula | C33H29NO6S |
| Molecular Weight | 567.66 g/mol |
| Exact Mass | 567.17 |
| IUPAC Name | benzyl (3S,3aR,7aR)-1-(4-methylphenyl)sulfonyl-2,5-dioxo-7a-phenylspiro[3a,4-dihydroindole-3,4'-cyclopentene]-1'-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)[C@]3(CC=C(C(=O)OCc4ccccc4)C3)[C@H]3CC(=O)C=C[C@]32c2ccccc2)cc1 |
| InChI | InChI=1S/C33H29NO6S/c1-23-12-14-28(15-13-23)41(38,39)34-31(37)32(18-16-25(21-32)30(36)40-22-24-8-4-2-5-9-24)29-20-27(35)17-19-33(29,34)26-10-6-3-7-11-26/h2-17,19,29H,18,20-22H2,1H3/t29-,32+,33+/m1/s1 |
| InChIKey | LEZHKOBMCCYNJB-CDSZWMAJSA-N |
| XLogP | 5.02 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.66 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |