C10H10F8N2O4 — CID 154726403
3-[4-(2-carboxyethyl)-2,2,3,3,5,5,6,6-octafluoropiperazin-1-yl]propanoic acid (PubChem CID 154726403) has the molecular formula C10H10F8N2O4 and a molecular weight of 374.18 g/mol. Its IUPAC name is 3-[4-(2-carboxyethyl)-2,2,3,3,5,5,6,6-octafluoropiperazin-1-yl]propanoic acid.
| Compound Name | 3-[4-(2-carboxyethyl)-2,2,3,3,5,5,6,6-octafluoropiperazin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 154726403 |
| Molecular Formula | C10H10F8N2O4 |
| Molecular Weight | 374.18 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 3-[4-(2-carboxyethyl)-2,2,3,3,5,5,6,6-octafluoropiperazin-1-yl]propanoic acid |
| SMILES | O=C(O)CCN1C(F)(F)C(F)(F)N(CCC(=O)O)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10H10F8N2O4/c11-7(12)9(15,16)20(4-2-6(23)24)10(17,18)8(13,14)19(7)3-1-5(21)22/h1-4H2,(H,21,22)(H,23,24) |
| InChIKey | XDIOUADKLLFNFJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.18 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|