C17H16N2O4S — CID 154726990
(2R)-2-[2-(4-benzoylbenzoyl)hydrazinyl]-3-sulfanylpropanoic acid (PubChem CID 154726990) has the molecular formula C17H16N2O4S and a molecular weight of 344.39 g/mol. Its IUPAC name is (2R)-2-[2-(4-benzoylbenzoyl)hydrazinyl]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[2-(4-benzoylbenzoyl)hydrazinyl]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 154726990 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | (2R)-2-[2-(4-benzoylbenzoyl)hydrazinyl]-3-sulfanylpropanoic acid |
| SMILES | O=C(NN[C@@H](CS)C(=O)O)c1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H16N2O4S/c20-15(11-4-2-1-3-5-11)12-6-8-13(9-7-12)16(21)19-18-14(10-24)17(22)23/h1-9,14,18,24H,10H2,(H,19,21)(H,22,23)/t14-/m0/s1 |
| InChIKey | DKHKAOMDTGFPIX-AWEZNQCLSA-N |
| XLogP | 1.53 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|