C6H7Cl2F3N2O — CID 154733914
1-(3,3-dichloroprop-2-enyl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 154733914) has the molecular formula C6H7Cl2F3N2O and a molecular weight of 251.04 g/mol. Its IUPAC name is 1-(3,3-dichloroprop-2-enyl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(3,3-dichloroprop-2-enyl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 154733914 |
| Molecular Formula | C6H7Cl2F3N2O |
| Molecular Weight | 251.04 g/mol |
| Exact Mass | 249.99 |
| IUPAC Name | 1-(3,3-dichloroprop-2-enyl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCC=C(Cl)Cl)NCC(F)(F)F |
| InChI | InChI=1S/C6H7Cl2F3N2O/c7-4(8)1-2-12-5(14)13-3-6(9,10)11/h1H,2-3H2,(H2,12,13,14) |
| InChIKey | PNHSFURDJFJFNH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.04 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |