C14H16ClF2NO2 — CID 154735577
[2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-2-azabicyclo[2.1.1]hexan-1-yl]methanol (PubChem CID 154735577) has the molecular formula C14H16ClF2NO2 and a molecular weight of 303.74 g/mol. Its IUPAC name is [2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-2-azabicyclo[2.1.1]hexan-1-yl]methanol.
| Compound Name | [2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-2-azabicyclo[2.1.1]hexan-1-yl]methanol |
|---|---|
| PubChem CID | 154735577 |
| Molecular Formula | C14H16ClF2NO2 |
| Molecular Weight | 303.74 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | [2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-2-azabicyclo[2.1.1]hexan-1-yl]methanol |
| SMILES | OCC12CC(CN1Cc1cc(Cl)ccc1OC(F)F)C2 |
| InChI | InChI=1S/C14H16ClF2NO2/c15-11-1-2-12(20-13(16)17)10(3-11)7-18-6-9-4-14(18,5-9)8-19/h1-3,9,13,19H,4-8H2 |
| InChIKey | QNXBABGTINPRIX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.74 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |