C19H24F2N2O4 — CID 154745313
N-[2-(2-cyclobutylpyrrolidin-1-yl)-2-oxoethyl]-4-(difluoromethoxy)-3-methoxybenzamide (PubChem CID 154745313) has the molecular formula C19H24F2N2O4 and a molecular weight of 382.41 g/mol. Its IUPAC name is N-[2-(2-cyclobutylpyrrolidin-1-yl)-2-oxoethyl]-4-(difluoromethoxy)-3-methoxybenzamide.
| Compound Name | N-[2-(2-cyclobutylpyrrolidin-1-yl)-2-oxoethyl]-4-(difluoromethoxy)-3-methoxybenzamide |
|---|---|
| PubChem CID | 154745313 |
| Molecular Formula | C19H24F2N2O4 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | N-[2-(2-cyclobutylpyrrolidin-1-yl)-2-oxoethyl]-4-(difluoromethoxy)-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)NCC(=O)N2CCCC2C2CCC2)ccc1OC(F)F |
| InChI | InChI=1S/C19H24F2N2O4/c1-26-16-10-13(7-8-15(16)27-19(20)21)18(25)22-11-17(24)23-9-3-6-14(23)12-4-2-5-12/h7-8,10,12,14,19H,2-6,9,11H2,1H3,(H,22,25) |
| InChIKey | PRPPOHAQXTXHMT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |