C18H20Cl2N2O3 — CID 154746153
N-[(3,5-dichlorophenyl)methyl]-2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)-N-methylacetamide (PubChem CID 154746153) has the molecular formula C18H20Cl2N2O3 and a molecular weight of 383.28 g/mol. Its IUPAC name is N-[(3,5-dichlorophenyl)methyl]-2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)-N-methylacetamide.
| Compound Name | N-[(3,5-dichlorophenyl)methyl]-2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 154746153 |
| Molecular Formula | C18H20Cl2N2O3 |
| Molecular Weight | 383.28 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | N-[(3,5-dichlorophenyl)methyl]-2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)-N-methylacetamide |
| SMILES | CN(Cc1cc(Cl)cc(Cl)c1)C(=O)CN1C(=O)CC2(CCCC2)C1=O |
| InChI | InChI=1S/C18H20Cl2N2O3/c1-21(10-12-6-13(19)8-14(20)7-12)16(24)11-22-15(23)9-18(17(22)25)4-2-3-5-18/h6-8H,2-5,9-11H2,1H3 |
| InChIKey | UNNFRQKGKHUPHZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.28 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|