C21H23N3O3S — CID 154751330
3-[1-(3-benzylsulfanylpropyl)-4-methyl-2,5-dioxoimidazolidin-4-yl]benzamide (PubChem CID 154751330) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is 3-[1-(3-benzylsulfanylpropyl)-4-methyl-2,5-dioxoimidazolidin-4-yl]benzamide.
| Compound Name | 3-[1-(3-benzylsulfanylpropyl)-4-methyl-2,5-dioxoimidazolidin-4-yl]benzamide |
|---|---|
| PubChem CID | 154751330 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 3-[1-(3-benzylsulfanylpropyl)-4-methyl-2,5-dioxoimidazolidin-4-yl]benzamide |
| SMILES | CC1(c2cccc(C(N)=O)c2)NC(=O)N(CCCSCc2ccccc2)C1=O |
| InChI | InChI=1S/C21H23N3O3S/c1-21(17-10-5-9-16(13-17)18(22)25)19(26)24(20(27)23-21)11-6-12-28-14-15-7-3-2-4-8-15/h2-5,7-10,13H,6,11-12,14H2,1H3,(H2,22,25)(H,23,27) |
| InChIKey | XZLAUXQUGJIXAW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|