C20H28N2O3S — CID 154759691
3-phenylpropyl 3-(cyclohexylcarbamoyl)-1,3-thiazolidine-4-carboxylate (PubChem CID 154759691) has the molecular formula C20H28N2O3S and a molecular weight of 376.52 g/mol. Its IUPAC name is 3-phenylpropyl 3-(cyclohexylcarbamoyl)-1,3-thiazolidine-4-carboxylate.
| Compound Name | 3-phenylpropyl 3-(cyclohexylcarbamoyl)-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 154759691 |
| Molecular Formula | C20H28N2O3S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 3-phenylpropyl 3-(cyclohexylcarbamoyl)-1,3-thiazolidine-4-carboxylate |
| SMILES | O=C(OCCCc1ccccc1)C1CSCN1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C20H28N2O3S/c23-19(25-13-7-10-16-8-3-1-4-9-16)18-14-26-15-22(18)20(24)21-17-11-5-2-6-12-17/h1,3-4,8-9,17-18H,2,5-7,10-15H2,(H,21,24) |
| InChIKey | KRZAJWAEPWELSJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|