C22H24N2O3 — CID 15476333
1',3',3'-trimethyl-6-nitro-8-prop-2-enylspiro[3,4-dihydrochromene-2,2'-indole] (PubChem CID 15476333) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 1',3',3'-trimethyl-6-nitro-8-prop-2-enylspiro[3,4-dihydrochromene-2,2'-indole].
| Compound Name | 1',3',3'-trimethyl-6-nitro-8-prop-2-enylspiro[3,4-dihydrochromene-2,2'-indole] |
|---|---|
| PubChem CID | 15476333 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 1',3',3'-trimethyl-6-nitro-8-prop-2-enylspiro[3,4-dihydrochromene-2,2'-indole] |
| SMILES | C=CCc1cc([N+](=O)[O-])cc2c1OC1(CC2)N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C22H24N2O3/c1-5-8-15-13-17(24(25)26)14-16-11-12-22(27-20(15)16)21(2,3)18-9-6-7-10-19(18)23(22)4/h5-7,9-10,13-14H,1,8,11-12H2,2-4H3 |
| InChIKey | FCXVPEZDBCHHPX-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|