C24H26N2O7 — CID 102394170
2-formyloxyethyl 3-(3',3'-dimethyl-6-nitrospiro[3,4-dihydrochromene-2,2'-indole]-1'-yl)propanoate (PubChem CID 102394170) has the molecular formula C24H26N2O7 and a molecular weight of 454.48 g/mol. Its IUPAC name is 2-formyloxyethyl 3-(3',3'-dimethyl-6-nitrospiro[3,4-dihydrochromene-2,2'-indole]-1'-yl)propanoate.
| Compound Name | 2-formyloxyethyl 3-(3',3'-dimethyl-6-nitrospiro[3,4-dihydrochromene-2,2'-indole]-1'-yl)propanoate |
|---|---|
| PubChem CID | 102394170 |
| Molecular Formula | C24H26N2O7 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 2-formyloxyethyl 3-(3',3'-dimethyl-6-nitrospiro[3,4-dihydrochromene-2,2'-indole]-1'-yl)propanoate |
| SMILES | CC1(C)c2ccccc2N(CCC(=O)OCCOC=O)C12CCc1cc([N+](=O)[O-])ccc1O2 |
| InChI | InChI=1S/C24H26N2O7/c1-23(2)19-5-3-4-6-20(19)25(12-10-22(28)32-14-13-31-16-27)24(23)11-9-17-15-18(26(29)30)7-8-21(17)33-24/h3-8,15-16H,9-14H2,1-2H3 |
| InChIKey | JRILMKINHHFYQX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|