C10H10ClF3N2O4S — CID 154775491
N-[(6-chloro-3-pyridinyl)methylsulfonyl]-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 154775491) has the molecular formula C10H10ClF3N2O4S and a molecular weight of 346.71 g/mol. Its IUPAC name is N-[(6-chloro-3-pyridinyl)methylsulfonyl]-2-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | N-[(6-chloro-3-pyridinyl)methylsulfonyl]-2-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 154775491 |
| Molecular Formula | C10H10ClF3N2O4S |
| Molecular Weight | 346.71 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | N-[(6-chloro-3-pyridinyl)methylsulfonyl]-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | O=C(COCC(F)(F)F)NS(=O)(=O)Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C10H10ClF3N2O4S/c11-8-2-1-7(3-15-8)5-21(18,19)16-9(17)4-20-6-10(12,13)14/h1-3H,4-6H2,(H,16,17) |
| InChIKey | ONXZJJLGZUGRSS-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.71 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|