C16H12ClN3O3S — CID 71882572
N-[(6-chloro-3-pyridinyl)methylsulfonyl]-3-(3-cyanophenyl)prop-2-enamide (PubChem CID 71882572) has the molecular formula C16H12ClN3O3S and a molecular weight of 361.81 g/mol. Its IUPAC name is N-[(6-chloro-3-pyridinyl)methylsulfonyl]-3-(3-cyanophenyl)prop-2-enamide.
| Compound Name | N-[(6-chloro-3-pyridinyl)methylsulfonyl]-3-(3-cyanophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 71882572 |
| Molecular Formula | C16H12ClN3O3S |
| Molecular Weight | 361.81 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | N-[(6-chloro-3-pyridinyl)methylsulfonyl]-3-(3-cyanophenyl)prop-2-enamide |
| SMILES | N#Cc1cccc(C=CC(=O)NS(=O)(=O)Cc2ccc(Cl)nc2)c1 |
| InChI | InChI=1S/C16H12ClN3O3S/c17-15-6-4-14(10-19-15)11-24(22,23)20-16(21)7-5-12-2-1-3-13(8-12)9-18/h1-8,10H,11H2,(H,20,21) |
| InChIKey | ITBAXRGMBKGQRF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 99.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.81 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|