C16H16ClN3O3S — CID 154797051
1-(6-chloropyridine-3-carbonyl)-N,N-dimethyl-2,3-dihydroindole-6-sulfonamide (PubChem CID 154797051) has the molecular formula C16H16ClN3O3S and a molecular weight of 365.84 g/mol. Its IUPAC name is 1-(6-chloropyridine-3-carbonyl)-N,N-dimethyl-2,3-dihydroindole-6-sulfonamide.
| Compound Name | 1-(6-chloropyridine-3-carbonyl)-N,N-dimethyl-2,3-dihydroindole-6-sulfonamide |
|---|---|
| PubChem CID | 154797051 |
| Molecular Formula | C16H16ClN3O3S |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 1-(6-chloropyridine-3-carbonyl)-N,N-dimethyl-2,3-dihydroindole-6-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc2c(c1)N(C(=O)c1ccc(Cl)nc1)CC2 |
| InChI | InChI=1S/C16H16ClN3O3S/c1-19(2)24(22,23)13-5-3-11-7-8-20(14(11)9-13)16(21)12-4-6-15(17)18-10-12/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | IGEGEPUEKZMENU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|