C20H26N4O2 — CID 154797334
1-[4-[[1-(2-oxo-1H-pyridin-4-yl)ethylamino]methyl]phenyl]piperidine-3-carboxamide (PubChem CID 154797334) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 1-[4-[[1-(2-oxo-1H-pyridin-4-yl)ethylamino]methyl]phenyl]piperidine-3-carboxamide.
| Compound Name | 1-[4-[[1-(2-oxo-1H-pyridin-4-yl)ethylamino]methyl]phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 154797334 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 1-[4-[[1-(2-oxo-1H-pyridin-4-yl)ethylamino]methyl]phenyl]piperidine-3-carboxamide |
| SMILES | CC(NCc1ccc(N2CCCC(C(N)=O)C2)cc1)c1cc[nH]c(=O)c1 |
| InChI | InChI=1S/C20H26N4O2/c1-14(16-8-9-22-19(25)11-16)23-12-15-4-6-18(7-5-15)24-10-2-3-17(13-24)20(21)26/h4-9,11,14,17,23H,2-3,10,12-13H2,1H3,(H2,21,26)(H,22,25) |
| InChIKey | GOZQJXIEQURHCI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|