C17H24N4O2S — CID 154806225
tert-butyl N-[5-[[3-(1,3-thiazol-2-yl)propylamino]methyl]-2-pyridinyl]carbamate (PubChem CID 154806225) has the molecular formula C17H24N4O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is tert-butyl N-[5-[[3-(1,3-thiazol-2-yl)propylamino]methyl]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[5-[[3-(1,3-thiazol-2-yl)propylamino]methyl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 154806225 |
| Molecular Formula | C17H24N4O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | tert-butyl N-[5-[[3-(1,3-thiazol-2-yl)propylamino]methyl]-2-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(CNCCCc2nccs2)cn1 |
| InChI | InChI=1S/C17H24N4O2S/c1-17(2,3)23-16(22)21-14-7-6-13(12-20-14)11-18-8-4-5-15-19-9-10-24-15/h6-7,9-10,12,18H,4-5,8,11H2,1-3H3,(H,20,21,22) |
| InChIKey | VSEHANKFHBEXAV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|