C25H37N5O3 — CID 59225232
tert-butyl N-[2-[[5-[[3-(diethylamino)propylamino]methyl]pyridine-2-carbonyl]amino]phenyl]carbamate (PubChem CID 59225232) has the molecular formula C25H37N5O3 and a molecular weight of 455.60 g/mol. Its IUPAC name is tert-butyl N-[2-[[5-[[3-(diethylamino)propylamino]methyl]pyridine-2-carbonyl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[5-[[3-(diethylamino)propylamino]methyl]pyridine-2-carbonyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 59225232 |
| Molecular Formula | C25H37N5O3 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.29 |
| IUPAC Name | tert-butyl N-[2-[[5-[[3-(diethylamino)propylamino]methyl]pyridine-2-carbonyl]amino]phenyl]carbamate |
| SMILES | CCN(CC)CCCNCc1ccc(C(=O)Nc2ccccc2NC(=O)OC(C)(C)C)nc1 |
| InChI | InChI=1S/C25H37N5O3/c1-6-30(7-2)16-10-15-26-17-19-13-14-22(27-18-19)23(31)28-20-11-8-9-12-21(20)29-24(32)33-25(3,4)5/h8-9,11-14,18,26H,6-7,10,15-17H2,1-5H3,(H,28,31)(H,29,32) |
| InChIKey | DBGWXMUBLLIJAQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|