C25H37N5O2 — CID 89119858
5-[[2-(diethylamino)ethylamino]methyl]-N-[2-[1-[(2-methylpropan-2-yl)oxy]ethenylamino]phenyl]pyridine-2-carboxamide (PubChem CID 89119858) has the molecular formula C25H37N5O2 and a molecular weight of 439.60 g/mol. Its IUPAC name is 5-[[2-(diethylamino)ethylamino]methyl]-N-[2-[1-[(2-methylpropan-2-yl)oxy]ethenylamino]phenyl]pyridine-2-carboxamide.
| Compound Name | 5-[[2-(diethylamino)ethylamino]methyl]-N-[2-[1-[(2-methylpropan-2-yl)oxy]ethenylamino]phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 89119858 |
| Molecular Formula | C25H37N5O2 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.29 |
| IUPAC Name | 5-[[2-(diethylamino)ethylamino]methyl]-N-[2-[1-[(2-methylpropan-2-yl)oxy]ethenylamino]phenyl]pyridine-2-carboxamide |
| SMILES | C=C(Nc1ccccc1NC(=O)c1ccc(CNCCN(CC)CC)cn1)OC(C)(C)C |
| InChI | InChI=1S/C25H37N5O2/c1-7-30(8-2)16-15-26-17-20-13-14-23(27-18-20)24(31)29-22-12-10-9-11-21(22)28-19(3)32-25(4,5)6/h9-14,18,26,28H,3,7-8,15-17H2,1-2,4-6H3,(H,29,31) |
| InChIKey | IYIYXAVXNBHJLX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|