C18H34I2N2 — CID 154810955
1-methyl-1-[5-(1-methylpyrrolidin-1-ium-1-yl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]pyrrolidin-1-ium diiodide (PubChem CID 154810955) has the molecular formula C18H34I2N2 and a molecular weight of 532.29 g/mol. Its IUPAC name is 1-methyl-1-[5-(1-methylpyrrolidin-1-ium-1-yl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]pyrrolidin-1-ium diiodide.
| Compound Name | 1-methyl-1-[5-(1-methylpyrrolidin-1-ium-1-yl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]pyrrolidin-1-ium diiodide |
|---|---|
| PubChem CID | 154810955 |
| Molecular Formula | C18H34I2N2 |
| Molecular Weight | 532.29 g/mol |
| Exact Mass | 532.08 |
| IUPAC Name | 1-methyl-1-[5-(1-methylpyrrolidin-1-ium-1-yl)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]pyrrolidin-1-ium diiodide |
| SMILES | C[N+]1(C2CC3CC([N+]4(C)CCCC4)CC3C2)CCCC1.[I-].[I-] |
| InChI | InChI=1S/C18H34N2.2HI/c1-19(7-3-4-8-19)17-11-15-13-18(14-16(15)12-17)20(2)9-5-6-10-20;;/h15-18H,3-14H2,1-2H3;2*1H/q+2;;/p-2 |
| InChIKey | NEVXCHOXZUNYMZ-UHFFFAOYSA-L |
| XLogP | -2.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.29 |
| LogP ≤ 5 | -2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|