C33H43N9O4 — CID 154816081
10-(2-amino-4-phenylpyrimidine-5-carbonyl)-3,18-dimethyl-13-(3-methylbutyl)-3,6,10,13,18,19-hexazatricyclo[12.5.2.017,20]henicosa-1(19),17(20)-diene-2,5,12-trione (PubChem CID 154816081) has the molecular formula C33H43N9O4 and a molecular weight of 629.77 g/mol. Its IUPAC name is 10-(2-amino-4-phenylpyrimidine-5-carbonyl)-3,18-dimethyl-13-(3-methylbutyl)-3,6,10,13,18,19-hexazatricyclo[12.5.2.017,20]henicosa-1(19),17(20)-diene-2,5,12-trione.
| Compound Name | 10-(2-amino-4-phenylpyrimidine-5-carbonyl)-3,18-dimethyl-13-(3-methylbutyl)-3,6,10,13,18,19-hexazatricyclo[12.5.2.017,20]henicosa-1(19),17(20)-diene-2,5,12-trione |
|---|---|
| PubChem CID | 154816081 |
| Molecular Formula | C33H43N9O4 |
| Molecular Weight | 629.77 g/mol |
| Exact Mass | 629.34 |
| IUPAC Name | 10-(2-amino-4-phenylpyrimidine-5-carbonyl)-3,18-dimethyl-13-(3-methylbutyl)-3,6,10,13,18,19-hexazatricyclo[12.5.2.017,20]henicosa-1(19),17(20)-diene-2,5,12-trione |
| SMILES | CC(C)CCN1C(=O)CN(C(=O)c2cnc(N)nc2-c2ccccc2)CCCNC(=O)CN(C)C(=O)c2nn(C)c3c2CC1CC3 |
| InChI | InChI=1S/C33H43N9O4/c1-21(2)13-16-42-23-11-12-26-24(17-23)30(38-40(26)4)32(46)39(3)19-27(43)35-14-8-15-41(20-28(42)44)31(45)25-18-36-33(34)37-29(25)22-9-6-5-7-10-22/h5-7,9-10,18,21,23H,8,11-17,19-20H2,1-4H3,(H,35,43)(H2,34,36,37) |
| InChIKey | HONGUVWZLNVYGK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 159.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.77 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |