C23H29NO3Si — CID 15483168
methyl (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3-dihydropyrrole-1-carboxylate (PubChem CID 15483168) has the molecular formula C23H29NO3Si and a molecular weight of 395.58 g/mol. Its IUPAC name is methyl (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3-dihydropyrrole-1-carboxylate.
| Compound Name | methyl (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 15483168 |
| Molecular Formula | C23H29NO3Si |
| Molecular Weight | 395.58 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | methyl (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3-dihydropyrrole-1-carboxylate |
| SMILES | COC(=O)N1C=CC[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H29NO3Si/c1-23(2,3)28(20-13-7-5-8-14-20,21-15-9-6-10-16-21)27-18-19-12-11-17-24(19)22(25)26-4/h5-11,13-17,19H,12,18H2,1-4H3/t19-/m0/s1 |
| InChIKey | SJILYINEMYZWNT-IBGZPJMESA-N |
| XLogP | 3.92 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.58 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|